CAS 231291-22-8 appears in our catalog under these names: 6-Trifluoromethyl Nicotinic Acid, 6–(Trifluoromethyl)nicotinic acid, 6-(Trifluoromethyl)nicotinic acid, 97% , 6-(Trifluoromethyl)nicotinic Acid, >98.0%(GC), 6-(Trifluoromethyl)nicotinic acid 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 2,5g, 5g, 25g, 250mg, 1000g, 10g, 100g.
6-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 231291-22-8) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 6-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: JNYLMODTPLSLIF-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 6-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | JNYLMODTPLSLIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)