CAS 231297-62-4 appears in our catalog under these names: 3-Fluoro-4-chlorophenacyl bromide 95%, 2–Bromo–1–(4–chloro–3–fluorophenyl)ethanone, 2-Bromo-1-(4-chloro-3-fluorophenyl)ethanone, 2-Bromo-1-(4-chloro-3-fluorophenyl)ethan-1-one, 98%. Offered by: Ambeed, GLPBio, Biosynth, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 2g, 10g.
2-bromo-1-(4-chloro-3-fluorophenyl)ethanone (CAS 231297-62-4) is a chemical compound with the molecular formula C8H5BrClFO and a molecular weight of 251.48 g/mol. IUPAC name: 2-bromo-1-(4-chloro-3-fluorophenyl)ethanone. InChIKey: CZERMIWLAGUTQP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO |
|---|---|
| Molecular weight | 251.48 g/mol |
| IUPAC name | 2-bromo-1-(4-chloro-3-fluorophenyl)ethanone |
| InChIKey | CZERMIWLAGUTQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)F)Cl |
Computed by PubChem (NCBI)