CAS 23132-59-4 is the registry number for Methadone Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-2-phenylacetonitrile (CAS 23132-59-4) is a chemical compound with the molecular formula C8H5Br2N and a molecular weight of 274.94 g/mol. IUPAC name: 2,2-dibromo-2-phenylacetonitrile. InChIKey: LUCUKMQQOXOQTM-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2N |
|---|---|
| Molecular weight | 274.94 g/mol |
| IUPAC name | 2,2-dibromo-2-phenylacetonitrile |
| InChIKey | LUCUKMQQOXOQTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C#N)(Br)Br |
Computed by PubChem (NCBI)