Products 2321343-06-8
CAS 2321343-06-8 appears in our catalog under these names: RT–NH2, RT-NH2, 95.0%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5 mg, 25 mg, 10 mg, 100 mg, 50 mg.
(E)-3-[7-(azetidin-1-yl)-2-oxochromen-3-yl]-2-cyanoprop-2-enamide (CAS 2321343-06-8) is a chemical compound with the molecular formula C16H13N3O3 and a molecular weight of 295.29 g/mol. IUPAC name: (E)-3-[7-(azetidin-1-yl)-2-oxochromen-3-yl]-2-cyanoprop-2-enamide. InChIKey: ACUFSVRPYXSWCJ-KPKJPENVSA-N.
| Molecular formula | C16H13N3O3 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (E)-3-[7-(azetidin-1-yl)-2-oxochromen-3-yl]-2-cyanoprop-2-enamide |
| InChIKey | ACUFSVRPYXSWCJ-KPKJPENVSA-N |
| SMILES | C1CN(C1)C2=CC3=C(C=C2)C=C(C(=O)O3)/C=C(\C#N)/C(=O)N |
Computed by PubChem (NCBI)