CAS 23292-08-2 appears in our catalog under these names: 4–CAB (hydrochloride), 4-CAB (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 50mg, 10 mg, 5 mg, 25 mg, 50 mg.
1-(4-chlorophenyl)butan-2-amine;hydrochloride (CAS 23292-08-2) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: 1-(4-chlorophenyl)butan-2-amine;hydrochloride. InChIKey: ONHHOFHHYPUSFX-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 1-(4-chlorophenyl)butan-2-amine;hydrochloride |
| InChIKey | ONHHOFHHYPUSFX-UHFFFAOYSA-N |
| SMILES | CCC(CC1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)