CAS 23315-55-1 appears in our catalog under these names: 4,4'-Di-n-propoxyazoxybenzene, 95%, 4,4'–Dipropoxyazoxybenzene, 4,4'-Dipropoxyazoxybenzene, >98.0%(N)(GC). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 1g, 5g.
Oxido-(4-propoxyphenyl)-(4-propoxyphenyl)iminoazanium (CAS 23315-55-1) is a chemical compound with the molecular formula C18H22N2O3 and a molecular weight of 314.4 g/mol. IUPAC name: oxido-(4-propoxyphenyl)-(4-propoxyphenyl)iminoazanium. InChIKey: YRZFKJUPVCUDMX-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O3 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | oxido-(4-propoxyphenyl)-(4-propoxyphenyl)iminoazanium |
| InChIKey | YRZFKJUPVCUDMX-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC=C(C=C1)N=[N+](C2=CC=C(C=C2)OCCC)[O-] |
Computed by PubChem (NCBI)