CAS 41555-67-3 is the registry number for 3-(3,4-dimethoxyphenyl)-1,6,6-trimethyl-5,6,7-trihydro1H-indazol-4-one. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
3-(3,4-dimethoxyphenyl)-1,6,6-trimethyl-5,7-dihydroindazol-4-one (CAS 41555-67-3) is a chemical compound with the molecular formula C18H22N2O3 and a molecular weight of 314.4 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-1,6,6-trimethyl-5,7-dihydroindazol-4-one. InChIKey: PNOPLSGEKSHEJN-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O3 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-1,6,6-trimethyl-5,7-dihydroindazol-4-one |
| InChIKey | PNOPLSGEKSHEJN-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1)C(=NN2C)C3=CC(=C(C=C3)OC)OC)C |
Computed by PubChem (NCBI)