CAS 23495-65-0 appears in our catalog under these names: Nicergoline Impurity 16, Nicergoline Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (6aR,9R,10aR)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinoline-9-carboxylate (CAS 23495-65-0) is a chemical compound with the molecular formula C18H22N2O3 and a molecular weight of 314.4 g/mol. IUPAC name: methyl (6aR,9R,10aR)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinoline-9-carboxylate. InChIKey: SCWPBCNOFOVVGZ-CDHAZOANSA-N.
| Molecular formula | C18H22N2O3 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | methyl (6aR,9R,10aR)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-fg]quinoline-9-carboxylate |
| InChIKey | SCWPBCNOFOVVGZ-CDHAZOANSA-N |
| SMILES | CN1C[C@@H](C[C@@]2([C@H]1CC3=CNC4=CC=CC2=C34)OC)C(=O)OC |
Computed by PubChem (NCBI)