CAS 885010-38-8 is the registry number for 4–((Adamantan–1–ylcarbamoyl)amino)benzoic acid. Offered by: GLPBio. Available pack sizes: 5mg.
4-(1-adamantylcarbamoylamino)benzoic acid (CAS 885010-38-8) is a chemical compound with the molecular formula C18H22N2O3 and a molecular weight of 314.4 g/mol. IUPAC name: 4-(1-adamantylcarbamoylamino)benzoic acid. InChIKey: KBCDTFQYSZRNRK-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O3 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 4-(1-adamantylcarbamoylamino)benzoic acid |
| InChIKey | KBCDTFQYSZRNRK-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)NC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)