Products 419558-95-5

CAS 419558-95-5 is the registry number for 6-(4-Phenylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

6-(4-phenylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid (CAS 419558-95-5) is a chemical compound with the molecular formula C18H22N2O3 and a molecular weight of 314.4 g/mol. IUPAC name: 6-(4-phenylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid. InChIKey: HNQQDXNTKOUXOE-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22N2O3
Molecular weight314.4 g/mol
IUPAC name6-(4-phenylpiperazine-1-carbonyl)cyclohex-3-ene-1-carboxylic acid
InChIKeyHNQQDXNTKOUXOE-UHFFFAOYSA-N
SMILESC1CN(CCN1C2=CC=CC=C2)C(=O)C3CC=CCC3C(=O)O

Computed by PubChem (NCBI)