Products 2339-98-2

CAS 2339-98-2 is the registry number for 2-(3-Fluorophenyl)-2-methoxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(3-fluorophenyl)-2-methoxyacetic acid (CAS 2339-98-2) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-(3-fluorophenyl)-2-methoxyacetic acid. InChIKey: RUEOWXMUAGCDCZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO3
Molecular weight184.16 g/mol
IUPAC name2-(3-fluorophenyl)-2-methoxyacetic acid
InChIKeyRUEOWXMUAGCDCZ-UHFFFAOYSA-N
SMILESCOC(C1=CC(=CC=C1)F)C(=O)O

Computed by PubChem (NCBI)