Products 234081-96-0
CAS 234081-96-0 appears in our catalog under these names: 10-(Tert-Butoxy)-10-Oxodecanoic Acid, 97%, 97%, 10-(tert-Butoxy)-10-oxodecanoic acid, 99.82%, 10-(tert-Butoxy)-10-oxodecanoic acid, 97%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
10-[(2-methylpropan-2-yl)oxy]-10-oxodecanoic acid (CAS 234081-96-0) is a chemical compound with the molecular formula C14H26O4 and a molecular weight of 258.35 g/mol. IUPAC name: 10-[(2-methylpropan-2-yl)oxy]-10-oxodecanoic acid. InChIKey: FRIYHISQFBWFCN-UHFFFAOYSA-N.
| Molecular formula | C14H26O4 |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | 10-[(2-methylpropan-2-yl)oxy]-10-oxodecanoic acid |
| InChIKey | FRIYHISQFBWFCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCC(=O)O |
Computed by PubChem (NCBI)