Products 2342596-62-5

CAS 2342596-62-5 is the registry number for 1-Benzyl 3-methyl 4-hydroxypiperidine-1,3-dicarboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5g, 10g.

Structural formula: {0} (CAS {1})

1-O-benzyl 3-O-methyl 4-hydroxypiperidine-1,3-dicarboxylate (CAS 2342596-62-5) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl 4-hydroxypiperidine-1,3-dicarboxylate. InChIKey: NWLQXLSBIKFHMT-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO5
Molecular weight293.31 g/mol
IUPAC name1-O-benzyl 3-O-methyl 4-hydroxypiperidine-1,3-dicarboxylate
InChIKeyNWLQXLSBIKFHMT-UHFFFAOYSA-N
SMILESCOC(=O)C1CN(CCC1O)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)