Products 2380977-54-6

CAS 2380977-54-6 is the registry number for 1-benzyl 3-methyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-benzyl 3-O-methyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate (CAS 2380977-54-6) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate. InChIKey: NWLQXLSBIKFHMT-STQMWFEESA-N.

Identity
Molecular formulaC15H19NO5
Molecular weight293.31 g/mol
IUPAC name1-O-benzyl 3-O-methyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate
InChIKeyNWLQXLSBIKFHMT-STQMWFEESA-N
SMILESCOC(=O)[C@H]1CN(CC[C@@H]1O)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)