CAS 2380977-54-6 is the registry number for 1-benzyl 3-methyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-O-benzyl 3-O-methyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate (CAS 2380977-54-6) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate. InChIKey: NWLQXLSBIKFHMT-STQMWFEESA-N.
| Molecular formula | C15H19NO5 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | 1-O-benzyl 3-O-methyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate |
| InChIKey | NWLQXLSBIKFHMT-STQMWFEESA-N |
| SMILES | COC(=O)[C@H]1CN(CC[C@@H]1O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)