Products 2343964-11-2
CAS 2343964-11-2 is the registry number for (3R,4R)-3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-4-methoxypentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxypentanoic acid (CAS 2343964-11-2) is a chemical compound with the molecular formula C21H23NO5 and a molecular weight of 369.4 g/mol. IUPAC name: (3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxypentanoic acid. InChIKey: AEQYEQGAOKXHCX-BFUOFWGJSA-N.
| Molecular formula | C21H23NO5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxypentanoic acid |
| InChIKey | AEQYEQGAOKXHCX-BFUOFWGJSA-N |
| SMILES | C[C@H]([C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC |
Computed by PubChem (NCBI)