Products 2344678-10-8

CAS 2344678-10-8 is the registry number for Methyl 1-amino-3-methylcyclobutane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 1-amino-3-methylcyclobutane-1-carboxylate;hydrochloride (CAS 2344678-10-8) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: methyl 1-amino-3-methylcyclobutane-1-carboxylate;hydrochloride. InChIKey: MAZJVIJPFKQUNE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC namemethyl 1-amino-3-methylcyclobutane-1-carboxylate;hydrochloride
InChIKeyMAZJVIJPFKQUNE-UHFFFAOYSA-N
SMILESCC1CC(C1)(C(=O)OC)N.Cl

Computed by PubChem (NCBI)