CAS 2344678-39-1 appears in our catalog under these names: tert-Butyl 2-azaspiro(3.3)heptane-6-carboxylate hydrochloride, 98%, tert-Butyl 2-azaspiro[3.3]heptane-6-carboxylate hydrochloride, 97%, 97%, tert-Butyl 2-azaspiro[3.3]heptane-6-carboxylate hydrochloride, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
Tert-butyl 2-azaspiro[3.3]heptane-6-carboxylate;hydrochloride (CAS 2344678-39-1) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: tert-butyl 2-azaspiro[3.3]heptane-6-carboxylate;hydrochloride. InChIKey: PNBPAYXFOJACPS-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | tert-butyl 2-azaspiro[3.3]heptane-6-carboxylate;hydrochloride |
| InChIKey | PNBPAYXFOJACPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC2(C1)CNC2.Cl |
Computed by PubChem (NCBI)