Products 2344679-64-5
CAS 2344679-64-5 is the registry number for 2-(2-Chloro-6-methoxyphenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2-chloro-6-methoxyphenyl)ethanamine;hydrochloride (CAS 2344679-64-5) is a chemical compound with the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. IUPAC name: 2-(2-chloro-6-methoxyphenyl)ethanamine;hydrochloride. InChIKey: FICAKSPDAPAHNX-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 2-(2-chloro-6-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | FICAKSPDAPAHNX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)Cl)CCN.Cl |
Computed by PubChem (NCBI)