Products 2344680-87-9
CAS 2344680-87-9 is the registry number for 5-(3,4-Dihydro-2H-1,4-benzoxazin-6-yl)thiophene-2-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)thiophene-2-carbonitrile (CAS 2344680-87-9) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 5-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)thiophene-2-carbonitrile. InChIKey: NVLXNPYMTATNIU-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 5-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)thiophene-2-carbonitrile |
| InChIKey | NVLXNPYMTATNIU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=C(C=C2)C3=CC=C(S3)C#N |
Computed by PubChem (NCBI)