Products 2349706-36-9
CAS 2349706-36-9 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(3-cyanophenyl)butanoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-4-(3-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 2349706-36-9) is a chemical compound with the molecular formula C26H22N2O4 and a molecular weight of 426.5 g/mol. IUPAC name: (2S)-4-(3-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LEVGFBKVOHPFHO-DEOSSOPVSA-N.
| Molecular formula | C26H22N2O4 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2S)-4-(3-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LEVGFBKVOHPFHO-DEOSSOPVSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC4=CC(=CC=C4)C#N)C(=O)O |
Computed by PubChem (NCBI)