Products 2351222-44-9
CAS 2351222-44-9 is the registry number for 6-Chloro-4-methoxybenzo[d]thiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-methoxy-1,3-benzothiazol-2-amine (CAS 2351222-44-9) is a chemical compound with the molecular formula C8H7ClN2OS and a molecular weight of 214.67 g/mol. IUPAC name: 6-chloro-4-methoxy-1,3-benzothiazol-2-amine. InChIKey: ZZVNZCMWLNDFBQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2OS |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 6-chloro-4-methoxy-1,3-benzothiazol-2-amine |
| InChIKey | ZZVNZCMWLNDFBQ-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)Cl)SC(=N2)N |
Computed by PubChem (NCBI)