CAS 568577-81-1 appears in our catalog under these names: 2-(Chloromethyl)-5-methylthieno[2,3-d]pyrimidin-4(3h)-one, 95%, 2–(Chloromethyl)–5–methylthieno(2,3–d)pyrimidin–4(3H)–one, 2-(Chloromethyl)-5-methylthieno[2,3-d]pyrimidin-4(3H)-one, 95+%, 95+%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
2-(chloromethyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 568577-81-1) is a chemical compound with the molecular formula C8H7ClN2OS and a molecular weight of 214.67 g/mol. IUPAC name: 2-(chloromethyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: NPCDJJHBOSYDKS-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2OS |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 2-(chloromethyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | NPCDJJHBOSYDKS-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=C1C(=O)NC(=N2)CCl |
Computed by PubChem (NCBI)