CAS 878699-59-3 appears in our catalog under these names: 2-(Chloromethyl)-6-methylthieno[2,3-d]pyrimidin-4(1h)-one, 95%, 2-(Chloromethyl)-6-methylthieno[2,3-d]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(chloromethyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 878699-59-3) is a chemical compound with the molecular formula C8H7ClN2OS and a molecular weight of 214.67 g/mol. IUPAC name: 2-(chloromethyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: MXAYFCHUXRRPQJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2OS |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | MXAYFCHUXRRPQJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)N=C(NC2=O)CCl |
Computed by PubChem (NCBI)