CAS 943656-55-1 appears in our catalog under these names: 7-(Chloromethyl)-2-methyl-5h-[1,3]thiazolo[3,2-a]pyrimidin-5-one, 95%, 7–(chloromethyl)–2–methyl–5H–(1,3)thiazolo(3,2–a)pyrimidin–5–one, 7-(Chloromethyl)-2-methyl-5H-thiazolo[3,2-a]pyrimidin-5-one, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
7-(chloromethyl)-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CAS 943656-55-1) is a chemical compound with the molecular formula C8H7ClN2OS and a molecular weight of 214.67 g/mol. IUPAC name: 7-(chloromethyl)-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one. InChIKey: FNZCXIFIXPCDQH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2OS |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 7-(chloromethyl)-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| InChIKey | FNZCXIFIXPCDQH-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=O)C=C(N=C2S1)CCl |
Computed by PubChem (NCBI)