CAS 74821-70-8 is the registry number for 5-Chloro-6-methoxy-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-chloro-6-methoxy-1,3-benzothiazol-2-amine (CAS 74821-70-8) is a chemical compound with the molecular formula C8H7ClN2OS and a molecular weight of 214.67 g/mol. IUPAC name: 5-chloro-6-methoxy-1,3-benzothiazol-2-amine. InChIKey: WSLXLABOEWJWJL-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2OS |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 5-chloro-6-methoxy-1,3-benzothiazol-2-amine |
| InChIKey | WSLXLABOEWJWJL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)SC(=N2)N)Cl |
Computed by PubChem (NCBI)