CAS 2351275-42-6 is the registry number for Methyl 6-methyl-1H-pyrrolo[3,2-b]pyridine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-methyl-1H-pyrrolo[3,2-b]pyridine-5-carboxylate (CAS 2351275-42-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 6-methyl-1H-pyrrolo[3,2-b]pyridine-5-carboxylate. InChIKey: NRHJAHFQDXZFMR-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 6-methyl-1H-pyrrolo[3,2-b]pyridine-5-carboxylate |
| InChIKey | NRHJAHFQDXZFMR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CN2)N=C1C(=O)OC |
Computed by PubChem (NCBI)