CAS 2351929-82-1 appears in our catalog under these names: 2–Chloro–3–methyl–3H–pyrrolo(3,2–d)pyrimidin–4(5H)–one, 2-Chloro-3-methyl-3H-pyrrolo[3,2-d]pyrimidin-4(5H)-one, 98%, 98%, 2-Chloro-3-methyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one, 98%, 2-Chloro-3-methyl-3H-pyrrolo[3,2-d]pyrimidin-4(5H)-one, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-chloro-3-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-one (CAS 2351929-82-1) is a chemical compound with the molecular formula C7H6ClN3O and a molecular weight of 183.59 g/mol. IUPAC name: 2-chloro-3-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-one. InChIKey: BDJOTARCONITMN-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 2-chloro-3-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| InChIKey | BDJOTARCONITMN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C=CN2)N=C1Cl |
Computed by PubChem (NCBI)