CAS 2353261-33-1 is the registry number for Phenylephrine Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3-(2-chloro-1-hydroxyethyl)phenol (CAS 2353261-33-1) is a chemical compound with the molecular formula C8H8Cl2O2 and a molecular weight of 207.05 g/mol. IUPAC name: 4-chloro-3-(2-chloro-1-hydroxyethyl)phenol. InChIKey: COUNSWRILXJEFS-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2 |
|---|---|
| Molecular weight | 207.05 g/mol |
| IUPAC name | 4-chloro-3-(2-chloro-1-hydroxyethyl)phenol |
| InChIKey | COUNSWRILXJEFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(CCl)O)Cl |
Computed by PubChem (NCBI)