Products 2353933-46-5
CAS 2353933-46-5 is the registry number for 5-{4-[(tert-butoxy)carbonyl]morpholin-2-yl}-1,3-oxazole-4-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]-1,3-oxazole-4-carboxylic acid (CAS 2353933-46-5) is a chemical compound with the molecular formula C13H18N2O6 and a molecular weight of 298.29 g/mol. IUPAC name: 5-[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]-1,3-oxazole-4-carboxylic acid. InChIKey: AQEVNUANDLTIKE-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O6 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 5-[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-2-yl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | AQEVNUANDLTIKE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC(C1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)