Products 2354508-19-1
CAS 2354508-19-1 is the registry number for 3-(2-((tert-Butoxycarbonyl)amino)ethyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-methyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pyrazole-5-carboxylic acid (CAS 2354508-19-1) is a chemical compound with the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. IUPAC name: 1-methyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pyrazole-5-carboxylic acid. InChIKey: GWJBHFLATUQYSL-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O4 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 1-methyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pyrazole-5-carboxylic acid |
| InChIKey | GWJBHFLATUQYSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC1=NN(C(=C1)C(=O)O)C |
Computed by PubChem (NCBI)