Products 23589-06-2
CAS 23589-06-2 is the registry number for 3-(5-P-Tolyl-furan-2-yl)-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[5-(4-methylphenyl)furan-2-yl]propanoic acid (CAS 23589-06-2) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 3-[5-(4-methylphenyl)furan-2-yl]propanoic acid. InChIKey: XIEFXNUAGJCARS-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 3-[5-(4-methylphenyl)furan-2-yl]propanoic acid |
| InChIKey | XIEFXNUAGJCARS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-p-Tolyl-furan-2-yl)-propionic acid, 3-[5-(4-methylphenyl)-2-furyl]propanoic acid, 3-[5-(4-methylphenyl)furan-2-yl]propanoic acid, 3-(5-(p-Tolyl)furan-2-yl)propanoic acid, 3-(5- p -Tolyl-furan-2-yl)-propionic acid, 3-(5-p-tolylfuran-2-yl)propionic acid, 2-Furanpropanoicacid, 5-(4-methylphenyl)-, ChemDiv3_005237, Cambridge id 6838357, Oprea1_411789