Products 2361562-56-1
CAS 2361562-56-1 is the registry number for 4-(Diphenylamino)-2-hydroxybenzaldehyde oxime, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(hydroxyiminomethyl)-5-(N-phenylanilino)phenol (CAS 2361562-56-1) is a chemical compound with the molecular formula C19H16N2O2 and a molecular weight of 304.3 g/mol. IUPAC name: 2-(hydroxyiminomethyl)-5-(N-phenylanilino)phenol. InChIKey: MKPDJUVSKJUVSS-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O2 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 2-(hydroxyiminomethyl)-5-(N-phenylanilino)phenol |
| InChIKey | MKPDJUVSKJUVSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC(=C(C=C3)C=NO)O |
Computed by PubChem (NCBI)