Products 108446-74-8

CAS 108446-74-8 is the registry number for 3-(1-Phenyl-3-p-tolyl-1h-pyrazol-4-yl)-acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(E)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoic acid (CAS 108446-74-8) is a chemical compound with the molecular formula C19H16N2O2 and a molecular weight of 304.3 g/mol. IUPAC name: (E)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoic acid. InChIKey: VKOYKKRRVGLIMR-VAWYXSNFSA-N.

Identity
Molecular formulaC19H16N2O2
Molecular weight304.3 g/mol
IUPAC name(E)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoic acid
InChIKeyVKOYKKRRVGLIMR-VAWYXSNFSA-N
SMILESCC1=CC=C(C=C1)C2=NN(C=C2/C=C/C(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)