CAS 83803-96-7 is the registry number for 2-(2-Naphthoyl)-1-(m-toluoyl)hydrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-(3-methylbenzoyl)naphthalene-2-carbohydrazide (CAS 83803-96-7) is a chemical compound with the molecular formula C19H16N2O2 and a molecular weight of 304.3 g/mol. IUPAC name: N'-(3-methylbenzoyl)naphthalene-2-carbohydrazide. InChIKey: NOZDWMYGSUBAEE-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O2 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | N'-(3-methylbenzoyl)naphthalene-2-carbohydrazide |
| InChIKey | NOZDWMYGSUBAEE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NNC(=O)C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)