CAS 845288-09-7 is the registry number for 4-(5,6-Dihydro-4H-benzo[f]pyrrolo[1,2-a][1,4]diazepin-4-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(5,6-dihydro-4H-pyrrolo[1,2-a][1,4]benzodiazepin-4-yl)benzoic acid (CAS 845288-09-7) is a chemical compound with the molecular formula C19H16N2O2 and a molecular weight of 304.3 g/mol. IUPAC name: 4-(5,6-dihydro-4H-pyrrolo[1,2-a][1,4]benzodiazepin-4-yl)benzoic acid. InChIKey: KSERTGUHLVIODL-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O2 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 4-(5,6-dihydro-4H-pyrrolo[1,2-a][1,4]benzodiazepin-4-yl)benzoic acid |
| InChIKey | KSERTGUHLVIODL-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2N3C=CC=C3C(N1)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)