Products 2414326-81-9
CAS 2414326-81-9 is the registry number for (S)-2-(4-Methoxyquinolin-2-yl)-4-phenyl-4,5-dihydrooxazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-2-(4-methoxyquinolin-2-yl)-4-phenyl-4,5-dihydro-1,3-oxazole (CAS 2414326-81-9) is a chemical compound with the molecular formula C19H16N2O2 and a molecular weight of 304.3 g/mol. IUPAC name: (4S)-2-(4-methoxyquinolin-2-yl)-4-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: OKLYEOOEUKNTJY-QGZVFWFLSA-N.
| Molecular formula | C19H16N2O2 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | (4S)-2-(4-methoxyquinolin-2-yl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | OKLYEOOEUKNTJY-QGZVFWFLSA-N |
| SMILES | COC1=CC(=NC2=CC=CC=C21)C3=N[C@H](CO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)