Products 2417969-81-2
CAS 2417969-81-2 is the registry number for Benzyl 6-cyano-1,2,2a,7b-tetrahydro-3H-cyclobuta[b]indole-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 6-cyano-1,2,2a,7b-tetrahydrocyclobuta[b]indole-3-carboxylate (CAS 2417969-81-2) is a chemical compound with the molecular formula C19H16N2O2 and a molecular weight of 304.3 g/mol. IUPAC name: benzyl 6-cyano-1,2,2a,7b-tetrahydrocyclobuta[b]indole-3-carboxylate. InChIKey: SIWPNEFFGYYJIW-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O2 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | benzyl 6-cyano-1,2,2a,7b-tetrahydrocyclobuta[b]indole-3-carboxylate |
| InChIKey | SIWPNEFFGYYJIW-UHFFFAOYSA-N |
| SMILES | C1CC2C1C3=C(N2C(=O)OCC4=CC=CC=C4)C=CC(=C3)C#N |
Computed by PubChem (NCBI)