Products 2361644-65-5

CAS 2361644-65-5 is the registry number for 5,5-Dimethyl-4-oxo-4,5,6,7-tetrahydro-1-benzofuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5,5-dimethyl-4-oxo-6,7-dihydro-1-benzofuran-2-carboxylic acid (CAS 2361644-65-5) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 5,5-dimethyl-4-oxo-6,7-dihydro-1-benzofuran-2-carboxylic acid. InChIKey: GCPBTVFLLWEDFE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O4
Molecular weight208.21 g/mol
IUPAC name5,5-dimethyl-4-oxo-6,7-dihydro-1-benzofuran-2-carboxylic acid
InChIKeyGCPBTVFLLWEDFE-UHFFFAOYSA-N
SMILESCC1(CCC2=C(C1=O)C=C(O2)C(=O)O)C

Computed by PubChem (NCBI)