Products 2361658-51-5
CAS 2361658-51-5 is the registry number for (2E)-3-(2-{1-((tert-Butoxy)carbonyl)azetidin-3-yl}phenyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-3-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]phenyl]prop-2-enoic acid (CAS 2361658-51-5) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: (E)-3-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]phenyl]prop-2-enoic acid. InChIKey: SPVLFSGJLVGOPV-CMDGGOBGSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (E)-3-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]phenyl]prop-2-enoic acid |
| InChIKey | SPVLFSGJLVGOPV-CMDGGOBGSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=CC=CC=C2/C=C/C(=O)O |
Computed by PubChem (NCBI)