CAS 2361876-99-3 is the registry number for 7,7-Dioxo-5H,6H,8H-7λâ¶-thiopyrano(3,4-b)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7,7-dioxo-6,8-dihydro-5H-thiopyrano[3,4-b]pyridine-3-carboxylic acid (CAS 2361876-99-3) is a chemical compound with the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. IUPAC name: 7,7-dioxo-6,8-dihydro-5H-thiopyrano[3,4-b]pyridine-3-carboxylic acid. InChIKey: RAXANLMHRVUPEB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 7,7-dioxo-6,8-dihydro-5H-thiopyrano[3,4-b]pyridine-3-carboxylic acid |
| InChIKey | RAXANLMHRVUPEB-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC2=C1C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)