CAS 2363048-01-3 is the registry number for Ethyl 2,6-diethynylisonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2,6-diethynylpyridine-4-carboxylate (CAS 2363048-01-3) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: ethyl 2,6-diethynylpyridine-4-carboxylate. InChIKey: HLRRWPIRCWSWTO-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | ethyl 2,6-diethynylpyridine-4-carboxylate |
| InChIKey | HLRRWPIRCWSWTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1)C#C)C#C |
Computed by PubChem (NCBI)