Products 2363048-01-3

CAS 2363048-01-3 is the registry number for Ethyl 2,6-diethynylisonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2,6-diethynylpyridine-4-carboxylate (CAS 2363048-01-3) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: ethyl 2,6-diethynylpyridine-4-carboxylate. InChIKey: HLRRWPIRCWSWTO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9NO2
Molecular weight199.20 g/mol
IUPAC nameethyl 2,6-diethynylpyridine-4-carboxylate
InChIKeyHLRRWPIRCWSWTO-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=NC(=C1)C#C)C#C

Computed by PubChem (NCBI)