CAS 23662-66-0 appears in our catalog under these names: 1-Benzyl-4-methyl-pyridinium chloride, 95%, 95%, 1-Benzyl-4-methyl-pyridinium chloride. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
1-benzyl-4-methylpyridin-1-ium chloride (CAS 23662-66-0) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 1-benzyl-4-methylpyridin-1-ium chloride. InChIKey: LJHMBIINLKLHSI-UHFFFAOYSA-M.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 1-benzyl-4-methylpyridin-1-ium chloride |
| InChIKey | LJHMBIINLKLHSI-UHFFFAOYSA-M |
| SMILES | CC1=CC=[N+](C=C1)CC2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)