Products 2371027-12-0
CAS 2371027-12-0 is the registry number for 2,2'',6,6''-Tetramethyl-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-carboxy-2,6-dimethylphenyl)phenyl]-3,5-dimethylbenzoic acid (CAS 2371027-12-0) is a chemical compound with the molecular formula C24H22O4 and a molecular weight of 374.4 g/mol. IUPAC name: 4-[4-(4-carboxy-2,6-dimethylphenyl)phenyl]-3,5-dimethylbenzoic acid. InChIKey: UWKUHUJLXWKILJ-UHFFFAOYSA-N.
| Molecular formula | C24H22O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 4-[4-(4-carboxy-2,6-dimethylphenyl)phenyl]-3,5-dimethylbenzoic acid |
| InChIKey | UWKUHUJLXWKILJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=CC=C(C=C2)C3=C(C=C(C=C3C)C(=O)O)C)C)C(=O)O |
Computed by PubChem (NCBI)