CAS 108366-06-9 is the registry number for (2E,2'E)–diethyl 3,3'–(anthracene–9,10–diyl)diacrylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Ethyl (E)-3-[10-[(E)-3-ethoxy-3-oxoprop-1-enyl]anthracen-9-yl]prop-2-enoate (CAS 108366-06-9) is a chemical compound with the molecular formula C24H22O4 and a molecular weight of 374.4 g/mol. IUPAC name: ethyl (E)-3-[10-[(E)-3-ethoxy-3-oxoprop-1-enyl]anthracen-9-yl]prop-2-enoate. InChIKey: AHPXBDYNDZUWSS-WXUKJITCSA-N.
| Molecular formula | C24H22O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | ethyl (E)-3-[10-[(E)-3-ethoxy-3-oxoprop-1-enyl]anthracen-9-yl]prop-2-enoate |
| InChIKey | AHPXBDYNDZUWSS-WXUKJITCSA-N |
| SMILES | CCOC(=O)/C=C/C1=C2C(=C(C3=CC=CC=C13)/C=C/C(=O)OCC)C=CC=C2 |
Computed by PubChem (NCBI)