CAS 1354942-46-3 is the registry number for (E)-1-([1,1'-Biphenyl]-4-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(4-phenylphenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one (CAS 1354942-46-3) is a chemical compound with the molecular formula C24H22O4 and a molecular weight of 374.4 g/mol. IUPAC name: (E)-1-(4-phenylphenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one. InChIKey: CSFOHFJQKPEONX-FYWRMAATSA-N.
| Molecular formula | C24H22O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (E)-1-(4-phenylphenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | CSFOHFJQKPEONX-FYWRMAATSA-N |
| SMILES | COC1=C(C(=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)C3=CC=CC=C3)OC)OC |
Computed by PubChem (NCBI)