Products 37527-56-3
CAS 37527-56-3 appears in our catalog under these names: Diethyl [1,1′:4′,1′′-terphenyl]-4,4′′-dicarboxylate, 97%, Diethyl [1,1′:4′,1′′-terphenyl]-4,4′′-dicarboxylate, 97%, 97%, Diethyl [1,1′:4′,1′′-terphenyl]-4,4′′-dicarboxylate, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g.
Ethyl 4-[4-(4-ethoxycarbonylphenyl)phenyl]benzoate (CAS 37527-56-3) is a chemical compound with the molecular formula C24H22O4 and a molecular weight of 374.4 g/mol. IUPAC name: ethyl 4-[4-(4-ethoxycarbonylphenyl)phenyl]benzoate. InChIKey: SKTBNGALWHHGKN-UHFFFAOYSA-N.
| Molecular formula | C24H22O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | ethyl 4-[4-(4-ethoxycarbonylphenyl)phenyl]benzoate |
| InChIKey | SKTBNGALWHHGKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C(=O)OCC |
Computed by PubChem (NCBI)