Products 773112-63-3
CAS 773112-63-3 is the registry number for 3-(3,4-Bis(benzyloxy)phenyl)-2-methylprop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(E)-3-[3,4-bis(phenylmethoxy)phenyl]-2-methylprop-2-enoic acid (CAS 773112-63-3) is a chemical compound with the molecular formula C24H22O4 and a molecular weight of 374.4 g/mol. IUPAC name: (E)-3-[3,4-bis(phenylmethoxy)phenyl]-2-methylprop-2-enoic acid. InChIKey: QFWHHQMKIBIPNH-NBVRZTHBSA-N.
| Molecular formula | C24H22O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (E)-3-[3,4-bis(phenylmethoxy)phenyl]-2-methylprop-2-enoic acid |
| InChIKey | QFWHHQMKIBIPNH-NBVRZTHBSA-N |
| SMILES | C/C(=C\C1=CC(=C(C=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)/C(=O)O |
Computed by PubChem (NCBI)