Products 2451082-07-6
CAS 2451082-07-6 is the registry number for 5'-(tert-Butyl)-[1,1':3',1''-terphenyl]-3,3''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3-tert-butyl-5-(3-carboxyphenyl)phenyl]benzoic acid (CAS 2451082-07-6) is a chemical compound with the molecular formula C24H22O4 and a molecular weight of 374.4 g/mol. IUPAC name: 3-[3-tert-butyl-5-(3-carboxyphenyl)phenyl]benzoic acid. InChIKey: OQYCMLPVKDOUID-UHFFFAOYSA-N.
| Molecular formula | C24H22O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 3-[3-tert-butyl-5-(3-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | OQYCMLPVKDOUID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)