CAS 2374723-86-9 is the registry number for Hyperwightin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-7-(3,4-dihydroxyphenyl)-4-hydroxy-2-prop-1-en-2-yl-2,3-dihydrofuro[3,2-g]chromen-5-one (CAS 2374723-86-9) is a chemical compound with the molecular formula C20H16O6 and a molecular weight of 352.3 g/mol. IUPAC name: (2S)-7-(3,4-dihydroxyphenyl)-4-hydroxy-2-prop-1-en-2-yl-2,3-dihydrofuro[3,2-g]chromen-5-one. InChIKey: QJPRENFDYDGEJU-HNNXBMFYSA-N.
| Molecular formula | C20H16O6 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | (2S)-7-(3,4-dihydroxyphenyl)-4-hydroxy-2-prop-1-en-2-yl-2,3-dihydrofuro[3,2-g]chromen-5-one |
| InChIKey | QJPRENFDYDGEJU-HNNXBMFYSA-N |
| SMILES | CC(=C)[C@@H]1CC2=C(O1)C=C3C(=C2O)C(=O)C=C(O3)C4=CC(=C(C=C4)O)O |
Computed by PubChem (NCBI)