Products 2375269-82-0
CAS 2375269-82-0 is the registry number for 2-(3-(Pyridin-2-yloxy)phenoxy)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3-pyridin-2-yloxyphenoxy)acetic acid;hydrochloride (CAS 2375269-82-0) is a chemical compound with the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. IUPAC name: 2-(3-pyridin-2-yloxyphenoxy)acetic acid;hydrochloride. InChIKey: UOVVJPXGCZABAP-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO4 |
|---|---|
| Molecular weight | 281.69 g/mol |
| IUPAC name | 2-(3-pyridin-2-yloxyphenoxy)acetic acid;hydrochloride |
| InChIKey | UOVVJPXGCZABAP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC2=CC=CC(=C2)OCC(=O)O.Cl |
Computed by PubChem (NCBI)